C21H26F2N2O — CID 44523571
3-[1-[(3R)-3-amino-4-(3,4-difluorophenyl)butyl]piperidin-4-yl]phenol (PubChem CID 44523571) has the molecular formula C21H26F2N2O and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-[1-[(3R)-3-amino-4-(3,4-difluorophenyl)butyl]piperidin-4-yl]phenol.
| Compound Name | 3-[1-[(3R)-3-amino-4-(3,4-difluorophenyl)butyl]piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 44523571 |
| Molecular Formula | C21H26F2N2O |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-[1-[(3R)-3-amino-4-(3,4-difluorophenyl)butyl]piperidin-4-yl]phenol |
| SMILES | N[C@@H](CCN1CCC(c2cccc(O)c2)CC1)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H26F2N2O/c22-20-5-4-15(13-21(20)23)12-18(24)8-11-25-9-6-16(7-10-25)17-2-1-3-19(26)14-17/h1-5,13-14,16,18,26H,6-12,24H2/t18-/m0/s1 |
| InChIKey | RSNITYIFSZEHQA-SFHVURJKSA-N |
| XLogP | 3.81 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |