C20H30N2O2 — CID 95124446
3-[4-(3-hydroxyphenyl)piperidin-1-yl]-1-[(3R)-3-methylpiperidin-1-yl]propan-1-one (PubChem CID 95124446) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-[4-(3-hydroxyphenyl)piperidin-1-yl]-1-[(3R)-3-methylpiperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(3-hydroxyphenyl)piperidin-1-yl]-1-[(3R)-3-methylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95124446 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 3-[4-(3-hydroxyphenyl)piperidin-1-yl]-1-[(3R)-3-methylpiperidin-1-yl]propan-1-one |
| SMILES | C[C@@H]1CCCN(C(=O)CCN2CCC(c3cccc(O)c3)CC2)C1 |
| InChI | InChI=1S/C20H30N2O2/c1-16-4-3-10-22(15-16)20(24)9-13-21-11-7-17(8-12-21)18-5-2-6-19(23)14-18/h2,5-6,14,16-17,23H,3-4,7-13,15H2,1H3/t16-/m1/s1 |
| InChIKey | FFYBHDNAPZDRAB-MRXNPFEDSA-N |
| XLogP | 3.22 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |