C25H33F3N2O2 — CID 143739501
ethane;methyl N-[4-(3-phenylpiperidin-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 143739501) has the molecular formula C25H33F3N2O2 and a molecular weight of 450.55 g/mol. Its IUPAC name is ethane;methyl N-[4-(3-phenylpiperidin-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | ethane;methyl N-[4-(3-phenylpiperidin-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 143739501 |
| Molecular Formula | C25H33F3N2O2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | ethane;methyl N-[4-(3-phenylpiperidin-1-yl)-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC.COC(=O)NC(CCN1CCCC(c2ccccc2)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H27F3N2O2.C2H6/c1-30-23(29)27-19(12-18-13-21(25)22(26)14-20(18)24)9-11-28-10-5-8-17(15-28)16-6-3-2-4-7-16;1-2/h2-4,6-7,13-14,17,19H,5,8-12,15H2,1H3,(H,27,29);1-2H3 |
| InChIKey | LXLYGDIGNIKHME-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|