C22H32N2O5Si — CID 156858277
CID 156858277 (PubChem CID 156858277) has the molecular formula C22H32N2O5Si and a molecular weight of 432.59 g/mol.
| Compound Name | CID 156858277 |
|---|---|
| PubChem CID | 156858277 |
| Molecular Formula | C22H32N2O5Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H](NC(=O)OC(C)(C)C)[Si]CCC(=O)N1CCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C22H32N2O5Si/c1-22(2,3)29-21(27)23-19(20(26)28-4)30-14-12-18(25)24-13-8-11-17(15-24)16-9-6-5-7-10-16/h5-7,9-10,17,19H,8,11-15H2,1-4H3,(H,23,27)/t17?,19-/m0/s1 |
| InChIKey | JPWRZFKVBZZKOZ-NNBQYGFHSA-N |
| XLogP | 2.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|