C24H36N2O3 — CID 164832714
tert-butyl N-[[4-(3-phenylpiperidine-1-carbonyl)cyclohexyl]methyl]carbamate (PubChem CID 164832714) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is tert-butyl N-[[4-(3-phenylpiperidine-1-carbonyl)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(3-phenylpiperidine-1-carbonyl)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 164832714 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | tert-butyl N-[[4-(3-phenylpiperidine-1-carbonyl)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)N2CCCC(c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C24H36N2O3/c1-24(2,3)29-23(28)25-16-18-11-13-20(14-12-18)22(27)26-15-7-10-21(17-26)19-8-5-4-6-9-19/h4-6,8-9,18,20-21H,7,10-17H2,1-3H3,(H,25,28) |
| InChIKey | CHQACILKJBRDFR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |