C23H27F6N3O4 — CID 123286775
tert-butyl N-[4-oxo-4-[5-(2,2,2-trifluoroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 123286775) has the molecular formula C23H27F6N3O4 and a molecular weight of 523.47 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[5-(2,2,2-trifluoroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[5-(2,2,2-trifluoroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 123286775 |
| Molecular Formula | C23H27F6N3O4 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[5-(2,2,2-trifluoroacetyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)N1CCC2CN(C(=O)C(F)(F)F)CC21)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H27F6N3O4/c1-22(2,3)36-21(35)30-14(6-13-7-16(25)17(26)9-15(13)24)8-19(33)32-5-4-12-10-31(11-18(12)32)20(34)23(27,28)29/h7,9,12,14,18H,4-6,8,10-11H2,1-3H3,(H,30,35) |
| InChIKey | BKXLKNPXNUELMR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|