C22H29F6N3O4 — CID 143303284
tert-butyl N-[4-[3-hydroxy-2-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 143303284) has the molecular formula C22H29F6N3O4 and a molecular weight of 513.48 g/mol. Its IUPAC name is tert-butyl N-[4-[3-hydroxy-2-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[3-hydroxy-2-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 143303284 |
| Molecular Formula | C22H29F6N3O4 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | tert-butyl N-[4-[3-hydroxy-2-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)N1CCCNC(O)C1CC(F)(F)F)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H29F6N3O4/c1-21(2,3)35-20(34)30-13(7-12-8-15(24)16(25)10-14(12)23)9-18(32)31-6-4-5-29-19(33)17(31)11-22(26,27)28/h8,10,13,17,19,29,33H,4-7,9,11H2,1-3H3,(H,30,34) |
| InChIKey | AWKDQHUYZANRBN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|