C24H27F6N5O3 — CID 24778190
tert-butyl N-[(2R)-4-oxo-4-[(8R)-8-prop-2-enyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 24778190) has the molecular formula C24H27F6N5O3 and a molecular weight of 547.50 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-oxo-4-[(8R)-8-prop-2-enyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-oxo-4-[(8R)-8-prop-2-enyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 24778190 |
| Molecular Formula | C24H27F6N5O3 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | tert-butyl N-[(2R)-4-oxo-4-[(8R)-8-prop-2-enyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | C=CC[C@@H]1c2nnc(C(F)(F)F)n2CCN1C(=O)C[C@@H](Cc1cc(F)c(F)cc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H27F6N5O3/c1-5-6-18-20-32-33-21(24(28,29)30)35(20)8-7-34(18)19(36)11-14(31-22(37)38-23(2,3)4)9-13-10-16(26)17(27)12-15(13)25/h5,10,12,14,18H,1,6-9,11H2,2-4H3,(H,31,37)/t14-,18-/m1/s1 |
| InChIKey | MZDPJENLBVQPHZ-RDTXWAMCSA-N |
| XLogP | 4.70 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|