C26H37F3N4O4 — CID 142688319
tert-butyl N-[(2R)-4-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 142688319) has the molecular formula C26H37F3N4O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 142688319 |
| Molecular Formula | C26H37F3N4O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | tert-butyl N-[(2R)-4-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N1CCN(C(=O)NC2CCCCC2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H37F3N4O4/c1-26(2,3)37-25(36)31-19(13-17-14-21(28)22(29)16-20(17)27)15-23(34)32-9-11-33(12-10-32)24(35)30-18-7-5-4-6-8-18/h14,16,18-19H,4-13,15H2,1-3H3,(H,30,35)(H,31,36)/t19-/m1/s1 |
| InChIKey | XFGOASCJSTVIJN-LJQANCHMSA-N |
| XLogP | 4.12 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|