C23H31F6N5O3 — CID 145212128
tert-butyl N-[4-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane (PubChem CID 145212128) has the molecular formula C23H31F6N5O3 and a molecular weight of 539.52 g/mol. Its IUPAC name is tert-butyl N-[4-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[4-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 145212128 |
| Molecular Formula | C23H31F6N5O3 |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | tert-butyl N-[4-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane |
| SMILES | CC.[H]/N=C1\CN(C(=O)CC(Cc2cc(F)c(F)cc2F)NC(=O)OC(C)(C)C)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C21H25F6N5O3.C2H6/c1-20(2,3)35-19(34)30-12(6-11-7-14(23)15(24)9-13(11)22)8-17(33)31-4-5-32(16(28)10-31)18(29)21(25,26)27;1-2/h7,9,12,28-29H,4-6,8,10H2,1-3H3,(H,30,34);1-2H3/b28-16+,29-18+; |
| InChIKey | UCZDFZXFIBXTRG-UUYCLTLESA-N |
| XLogP | 4.62 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|