C24H25F6N5O — CID 123381747
1-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-3-(1-phenylethylamino)-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 123381747) has the molecular formula C24H25F6N5O and a molecular weight of 513.49 g/mol. Its IUPAC name is 1-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-3-(1-phenylethylamino)-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 1-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-3-(1-phenylethylamino)-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 123381747 |
| Molecular Formula | C24H25F6N5O |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 1-[3-imino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-3-(1-phenylethylamino)-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | [H]/N=C1\CN(C(=O)CC(Cc2cc(F)c(F)cc2F)NC(C)c2ccccc2)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C24H25F6N5O/c1-14(15-5-3-2-4-6-15)33-17(9-16-10-19(26)20(27)12-18(16)25)11-22(36)34-7-8-35(21(31)13-34)23(32)24(28,29)30/h2-6,10,12,14,17,31-33H,7-9,11,13H2,1H3/b31-21+,32-23+ |
| InChIKey | VSNSBOMGVZOOIF-VRIPTRIVSA-N |
| XLogP | 4.42 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|