C22H22F3NO6 — CID 71253135
(Z)-but-2-enedioic acid;(3S)-3-[[(1R)-1-phenylethyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 71253135) has the molecular formula C22H22F3NO6 and a molecular weight of 453.41 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(3S)-3-[[(1R)-1-phenylethyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | (Z)-but-2-enedioic acid;(3S)-3-[[(1R)-1-phenylethyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 71253135 |
| Molecular Formula | C22H22F3NO6 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;(3S)-3-[[(1R)-1-phenylethyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | C[C@@H](N[C@H](CC(=O)O)Cc1cc(F)c(F)cc1F)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H18F3NO2.C4H4O4/c1-11(12-5-3-2-4-6-12)22-14(9-18(23)24)7-13-8-16(20)17(21)10-15(13)19;5-3(6)1-2-4(7)8/h2-6,8,10-11,14,22H,7,9H2,1H3,(H,23,24);1-2H,(H,5,6)(H,7,8)/b;2-1-/t11-,14+;/m1./s1 |
| InChIKey | NODQDGDAQRRSQZ-KHTIRGFOSA-N |
| XLogP | 3.55 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|