C13H18F3NO2 — CID 153347348
ethane;3-(methylamino)-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 153347348) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is ethane;3-(methylamino)-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | ethane;3-(methylamino)-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 153347348 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethane;3-(methylamino)-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | CC.CNC(CC(=O)O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H12F3NO2.C2H6/c1-15-7(4-11(16)17)2-6-3-9(13)10(14)5-8(6)12;1-2/h3,5,7,15H,2,4H2,1H3,(H,16,17);1-2H3 |
| InChIKey | IYNYCXFXCOINMX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|