C20H20F6N2O4 — CID 174927990
3-amino-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 174927990) has the molecular formula C20H20F6N2O4 and a molecular weight of 466.38 g/mol. Its IUPAC name is 3-amino-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | 3-amino-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 174927990 |
| Molecular Formula | C20H20F6N2O4 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 3-amino-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | NC(CC(=O)O)Cc1cc(F)c(F)cc1F.NC(CC(=O)O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/2C10H10F3NO2/c2*11-7-4-9(13)8(12)2-5(7)1-6(14)3-10(15)16/h2*2,4,6H,1,3,14H2,(H,15,16) |
| InChIKey | DBEURMIBGXWFAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|