C15H13F3N2O2 — CID 175034055
1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrole-3-carbaldehyde (PubChem CID 175034055) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrole-3-carbaldehyde.
| Compound Name | 1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 175034055 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrole-3-carbaldehyde |
| SMILES | NC(CC(=O)n1ccc(C=O)c1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H13F3N2O2/c16-12-6-14(18)13(17)4-10(12)3-11(19)5-15(22)20-2-1-9(7-20)8-21/h1-2,4,6-8,11H,3,5,19H2 |
| InChIKey | MRWDYROWTUPZOZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|