C10H10F3NO2 — CID 7146283
(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 7146283) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 7146283 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | N[C@@H](CC(=O)O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H10F3NO2/c11-7-4-9(13)8(12)2-5(7)1-6(14)3-10(15)16/h2,4,6H,1,3,14H2,(H,15,16)/t6-/m1/s1 |
| InChIKey | KEFQQJVYCWLKPL-ZCFIWIBFSA-N |
| XLogP | 1.45 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|