C15H15F3N4O4 — CID 163202911
(4,6-dimethoxy-1,3,5-triazin-2-yl) (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 163202911) has the molecular formula C15H15F3N4O4 and a molecular weight of 372.30 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3,5-triazin-2-yl) (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 163202911 |
| Molecular Formula | C15H15F3N4O4 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | COc1nc(OC)nc(OC(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C15H15F3N4O4/c1-24-13-20-14(25-2)22-15(21-13)26-12(23)5-8(19)3-7-4-10(17)11(18)6-9(7)16/h4,6,8H,3,5,19H2,1-2H3/t8-/m1/s1 |
| InChIKey | XRSXIDAJISLKSI-MRVPVSSYSA-N |
| XLogP | 1.17 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|