C15H19F3N4O3 — CID 25177536
1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,2,5-triazepane-5-carboxylic acid (PubChem CID 25177536) has the molecular formula C15H19F3N4O3 and a molecular weight of 360.34 g/mol. Its IUPAC name is 1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,2,5-triazepane-5-carboxylic acid.
| Compound Name | 1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,2,5-triazepane-5-carboxylic acid |
|---|---|
| PubChem CID | 25177536 |
| Molecular Formula | C15H19F3N4O3 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,2,5-triazepane-5-carboxylic acid |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)O)CCN1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H19F3N4O3/c16-11-8-13(18)12(17)6-9(11)5-10(19)7-14(23)22-4-3-21(15(24)25)2-1-20-22/h6,8,10,20H,1-5,7,19H2,(H,24,25)/t10-/m1/s1 |
| InChIKey | FFSMJQJXEFPIAZ-SNVBAGLBSA-N |
| XLogP | 0.69 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|