C17H19F6N3O2 — CID 174627184
(3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(1,2,2-trifluoroethyl)-1,4-diazepan-2-one (PubChem CID 174627184) has the molecular formula C17H19F6N3O2 and a molecular weight of 411.35 g/mol. Its IUPAC name is (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(1,2,2-trifluoroethyl)-1,4-diazepan-2-one.
| Compound Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(1,2,2-trifluoroethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 174627184 |
| Molecular Formula | C17H19F6N3O2 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(1,2,2-trifluoroethyl)-1,4-diazepan-2-one |
| SMILES | N[C@@H](CC(=O)N1CCCNC(=O)[C@@H]1C(F)C(F)F)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H19F6N3O2/c18-10-7-12(20)11(19)5-8(10)4-9(24)6-13(27)26-3-1-2-25-17(28)15(26)14(21)16(22)23/h5,7,9,14-16H,1-4,6,24H2,(H,25,28)/t9-,14?,15+/m1/s1 |
| InChIKey | BSIKRKFTEFUCNB-OHRKYMRTSA-N |
| XLogP | 1.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|