C19H27Cl2F3N4O3 — CID 67428726
(3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(morpholin-4-ylmethyl)piperazin-2-one;dihydrochloride (PubChem CID 67428726) has the molecular formula C19H27Cl2F3N4O3 and a molecular weight of 487.35 g/mol. Its IUPAC name is (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(morpholin-4-ylmethyl)piperazin-2-one;dihydrochloride.
| Compound Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(morpholin-4-ylmethyl)piperazin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 67428726 |
| Molecular Formula | C19H27Cl2F3N4O3 |
| Molecular Weight | 487.35 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(morpholin-4-ylmethyl)piperazin-2-one;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](CC(=O)N1CCNC(=O)[C@H]1CN1CCOCC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H25F3N4O3.2ClH/c20-14-10-16(22)15(21)8-12(14)7-13(23)9-18(27)26-2-1-24-19(28)17(26)11-25-3-5-29-6-4-25;;/h8,10,13,17H,1-7,9,11,23H2,(H,24,28);2*1H/t13-,17-;;/m1../s1 |
| InChIKey | AOPBAUCNNSNYLA-OJYPLKCUSA-N |
| XLogP | 0.87 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|