C22H24F3N3O2 — CID 10454758
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-benzyl-1,4-diazepan-2-one (PubChem CID 10454758) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-benzyl-1,4-diazepan-2-one.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-benzyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 10454758 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-benzyl-1,4-diazepan-2-one |
| SMILES | N[C@@H](CC(=O)N1CCCNC(=O)C1Cc1ccccc1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H24F3N3O2/c23-17-13-19(25)18(24)11-15(17)10-16(26)12-21(29)28-8-4-7-27-22(30)20(28)9-14-5-2-1-3-6-14/h1-3,5-6,11,13,16,20H,4,7-10,12,26H2,(H,27,30)/t16-,20?/m1/s1 |
| InChIKey | JRLRAMRHJZSZIE-QRIPLOBPSA-N |
| XLogP | 2.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|