C19H26F3N3O3 — CID 168720932
(3R)-4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(2,2-dimethylpropoxy)piperazin-2-one (PubChem CID 168720932) has the molecular formula C19H26F3N3O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is (3R)-4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(2,2-dimethylpropoxy)piperazin-2-one.
| Compound Name | (3R)-4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(2,2-dimethylpropoxy)piperazin-2-one |
|---|---|
| PubChem CID | 168720932 |
| Molecular Formula | C19H26F3N3O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (3R)-4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(2,2-dimethylpropoxy)piperazin-2-one |
| SMILES | CC(C)(C)CO[C@@H]1C(=O)NCCN1C(=O)CC(N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H26F3N3O3/c1-19(2,3)10-28-18-17(27)24-4-5-25(18)16(26)8-12(23)6-11-7-14(21)15(22)9-13(11)20/h7,9,12,18H,4-6,8,10,23H2,1-3H3,(H,24,27)/t12?,18-/m1/s1 |
| InChIKey | PXDUYWYZDYIPTI-VMHBGOFLSA-N |
| XLogP | 1.71 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|