C18H21F6N3O2 — CID 23647128
(3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-6-methyl-3-(2,2,2-trifluoroethyl)-1,4-diazepan-2-one (PubChem CID 23647128) has the molecular formula C18H21F6N3O2 and a molecular weight of 425.37 g/mol. Its IUPAC name is (3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-6-methyl-3-(2,2,2-trifluoroethyl)-1,4-diazepan-2-one.
| Compound Name | (3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-6-methyl-3-(2,2,2-trifluoroethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 23647128 |
| Molecular Formula | C18H21F6N3O2 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (3R,6R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-6-methyl-3-(2,2,2-trifluoroethyl)-1,4-diazepan-2-one |
| SMILES | C[C@@H]1CNC(=O)[C@@H](CC(F)(F)F)N(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C18H21F6N3O2/c1-9-7-26-17(29)15(6-18(22,23)24)27(8-9)16(28)4-11(25)2-10-3-13(20)14(21)5-12(10)19/h3,5,9,11,15H,2,4,6-8,25H2,1H3,(H,26,29)/t9-,11-,15-/m1/s1 |
| InChIKey | OZHVWSQMEOKMIE-XDMRBOTDSA-N |
| XLogP | 2.28 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|