C19H27ClF3N3O2S — CID 67427535
4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(tert-butylsulfanylmethyl)piperazin-2-one;hydrochloride (PubChem CID 67427535) has the molecular formula C19H27ClF3N3O2S and a molecular weight of 453.96 g/mol. Its IUPAC name is 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(tert-butylsulfanylmethyl)piperazin-2-one;hydrochloride.
| Compound Name | 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(tert-butylsulfanylmethyl)piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 67427535 |
| Molecular Formula | C19H27ClF3N3O2S |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 4-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(tert-butylsulfanylmethyl)piperazin-2-one;hydrochloride |
| SMILES | CC(C)(C)SCC1C(=O)NCCN1C(=O)CC(N)Cc1cc(F)c(F)cc1F.Cl |
| InChI | InChI=1S/C19H26F3N3O2S.ClH/c1-19(2,3)28-10-16-18(27)24-4-5-25(16)17(26)8-12(23)6-11-7-14(21)15(22)9-13(11)20;/h7,9,12,16H,4-6,8,10,23H2,1-3H3,(H,24,27);1H |
| InChIKey | OOIZCGTVXPRMED-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|