C23H37F3N8O3 — CID 74766586
(3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;3-(diaminomethylidene)-1,1-dimethylguanidine (PubChem CID 74766586) has the molecular formula C23H37F3N8O3 and a molecular weight of 530.60 g/mol. Its IUPAC name is (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;3-(diaminomethylidene)-1,1-dimethylguanidine.
| Compound Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;3-(diaminomethylidene)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 74766586 |
| Molecular Formula | C23H37F3N8O3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one;3-(diaminomethylidene)-1,1-dimethylguanidine |
| SMILES | CC(C)(C)OC[C@@H]1C(=O)NCCN1C(=O)C[C@H](N)Cc1cc(F)c(F)cc1F.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C19H26F3N3O3.C4H11N5/c1-19(2,3)28-10-16-18(27)24-4-5-25(16)17(26)8-12(23)6-11-7-14(21)15(22)9-13(11)20;1-9(2)4(7)8-3(5)6/h7,9,12,16H,4-6,8,10,23H2,1-3H3,(H,24,27);1-2H3,(H5,5,6,7,8)/t12-,16-;/m1./s1 |
| InChIKey | IBLGXLJUWGXAQO-VQZRABBESA-N |
| XLogP | 0.26 |
| TPSA | 176.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|