C16H19F6N5O — CID 162576083
3-amino-1-[3-amino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 162576083) has the molecular formula C16H19F6N5O and a molecular weight of 411.35 g/mol. Its IUPAC name is 3-amino-1-[3-amino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-amino-1-[3-amino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 162576083 |
| Molecular Formula | C16H19F6N5O |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-amino-1-[3-amino-4-(2,2,2-trifluoroethanimidoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | [H]/N=C(/N1CCN(C(=O)CC(N)Cc2cc(F)c(F)cc2F)CC1N)C(F)(F)F |
| InChI | InChI=1S/C16H19F6N5O/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27(13(24)7-26)15(25)16(20,21)22/h4,6,9,13,25H,1-3,5,7,23-24H2/b25-15+ |
| InChIKey | FSQCPSWJWBPSNM-MFKUBSTISA-N |
| XLogP | 1.33 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|