C17H17F6N5O — CID 144686082
3-amino-1-[6-imino-5-(2,2,2-trifluoroethanimidoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 144686082) has the molecular formula C17H17F6N5O and a molecular weight of 421.35 g/mol. Its IUPAC name is 3-amino-1-[6-imino-5-(2,2,2-trifluoroethanimidoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-amino-1-[6-imino-5-(2,2,2-trifluoroethanimidoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 144686082 |
| Molecular Formula | C17H17F6N5O |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-amino-1-[6-imino-5-(2,2,2-trifluoroethanimidoyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | [H]/N=C1\C2CC(CN2C(=O)CC(N)Cc2cc(F)c(F)cc2F)N1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C17H17F6N5O/c18-10-5-12(20)11(19)2-7(10)1-8(24)3-14(29)27-6-9-4-13(27)15(25)28(9)16(26)17(21,22)23/h2,5,8-9,13,25-26H,1,3-4,6,24H2/b25-15+,26-16+ |
| InChIKey | HTDXKZOGFZEZOH-RYQLWAFASA-N |
| XLogP | 2.17 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|