C18H17F6N5O — CID 144686069
(3R)-3-amino-1-[(1R,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 144686069) has the molecular formula C18H17F6N5O and a molecular weight of 433.36 g/mol. Its IUPAC name is (3R)-3-amino-1-[(1R,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[(1R,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 144686069 |
| Molecular Formula | C18H17F6N5O |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (3R)-3-amino-1-[(1R,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1[C@H]2CC[C@@H]1c1nnc(C(F)(F)F)n1C2)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H17F6N5O/c19-11-6-13(21)12(20)4-8(11)3-9(25)5-15(30)29-10-1-2-14(29)16-26-27-17(18(22,23)24)28(16)7-10/h4,6,9-10,14H,1-3,5,7,25H2/t9-,10+,14-/m1/s1 |
| InChIKey | NAVCPRJKXCQDTL-ISTVAULSSA-N |
| XLogP | 2.72 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|