C18H19F4N5O — CID 78427502
(3R)-3-amino-4-(2-fluorophenyl)-1-[(1S,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]butan-1-one (PubChem CID 78427502) has the molecular formula C18H19F4N5O and a molecular weight of 397.38 g/mol. Its IUPAC name is (3R)-3-amino-4-(2-fluorophenyl)-1-[(1S,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2-fluorophenyl)-1-[(1S,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]butan-1-one |
|---|---|
| PubChem CID | 78427502 |
| Molecular Formula | C18H19F4N5O |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (3R)-3-amino-4-(2-fluorophenyl)-1-[(1S,8S)-5-(trifluoromethyl)-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]butan-1-one |
| SMILES | N[C@@H](CC(=O)N1[C@H]2CC[C@H]1c1nnc(C(F)(F)F)n1C2)Cc1ccccc1F |
| InChI | InChI=1S/C18H19F4N5O/c19-13-4-2-1-3-10(13)7-11(23)8-15(28)27-12-5-6-14(27)16-24-25-17(18(20,21)22)26(16)9-12/h1-4,11-12,14H,5-9,23H2/t11-,12+,14+/m1/s1 |
| InChIKey | ZMNISZLGTXWOKW-DYEKYZERSA-N |
| XLogP | 2.44 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |