C18H19F6N5O3 — CID 123529316
[7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-5,6,8,8a-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-1-yl] acetate (PubChem CID 123529316) has the molecular formula C18H19F6N5O3 and a molecular weight of 467.37 g/mol. Its IUPAC name is [7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-5,6,8,8a-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-1-yl] acetate.
| Compound Name | [7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-5,6,8,8a-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-1-yl] acetate |
|---|---|
| PubChem CID | 123529316 |
| Molecular Formula | C18H19F6N5O3 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-5,6,8,8a-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-1-yl] acetate |
| SMILES | CC(=O)ON1N=C(C(F)(F)F)N2CCN(C(=O)CC(N)Cc3cc(F)c(F)cc3F)CC12 |
| InChI | InChI=1S/C18H19F6N5O3/c1-9(30)32-29-15-8-27(2-3-28(15)17(26-29)18(22,23)24)16(31)6-11(25)4-10-5-13(20)14(21)7-12(10)19/h5,7,11,15H,2-4,6,8,25H2,1H3 |
| InChIKey | SKSVVNHWQKFPTB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|