C19H26F3N3O2 — CID 70338023
(3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-propyl-1,4-diazepan-2-one (PubChem CID 70338023) has the molecular formula C19H26F3N3O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-propyl-1,4-diazepan-2-one.
| Compound Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-propyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 70338023 |
| Molecular Formula | C19H26F3N3O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (3R)-4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-3-methyl-1-propyl-1,4-diazepan-2-one |
| SMILES | CCCN1CCCN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)[C@H](C)C1=O |
| InChI | InChI=1S/C19H26F3N3O2/c1-3-5-24-6-4-7-25(12(2)19(24)27)18(26)10-14(23)8-13-9-16(21)17(22)11-15(13)20/h9,11-12,14H,3-8,10,23H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | PWYUAERSMCBRFA-TZMCWYRMSA-N |
| XLogP | 2.22 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|