C18H20F5N5O — CID 142882752
3-amino-1-[2-(difluoromethyl)-5,8-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 142882752) has the molecular formula C18H20F5N5O and a molecular weight of 417.38 g/mol. Its IUPAC name is 3-amino-1-[2-(difluoromethyl)-5,8-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-amino-1-[2-(difluoromethyl)-5,8-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 142882752 |
| Molecular Formula | C18H20F5N5O |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-amino-1-[2-(difluoromethyl)-5,8-dimethyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | CC1c2nc(C(F)F)nn2C(C)CN1C(=O)CC(N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H20F5N5O/c1-8-7-27(9(2)18-25-17(16(22)23)26-28(8)18)15(29)5-11(24)3-10-4-13(20)14(21)6-12(10)19/h4,6,8-9,11,16H,3,5,7,24H2,1-2H3 |
| InChIKey | SFXLLBHKAWLKOB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|