C15H21F3N4O3S — CID 25177616
(3R)-3-amino-1-(5-methylsulfonyl-1,2,5-triazepan-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 25177616) has the molecular formula C15H21F3N4O3S and a molecular weight of 394.42 g/mol. Its IUPAC name is (3R)-3-amino-1-(5-methylsulfonyl-1,2,5-triazepan-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-(5-methylsulfonyl-1,2,5-triazepan-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 25177616 |
| Molecular Formula | C15H21F3N4O3S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (3R)-3-amino-1-(5-methylsulfonyl-1,2,5-triazepan-1-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | CS(=O)(=O)N1CCNN(C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C15H21F3N4O3S/c1-26(24,25)21-3-2-20-22(5-4-21)15(23)8-11(19)6-10-7-13(17)14(18)9-12(10)16/h7,9,11,20H,2-6,8,19H2,1H3/t11-/m1/s1 |
| InChIKey | MATHNMMOVUIRPR-LLVKDONJSA-N |
| XLogP | -0.03 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|