C11H10F3N3O — CID 173476816
(3R)-1-diazo-3-(methylamino)-4-(2,4,5-trifluorophenyl)butan-2-one (PubChem CID 173476816) has the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. Its IUPAC name is (3R)-1-diazo-3-(methylamino)-4-(2,4,5-trifluorophenyl)butan-2-one.
| Compound Name | (3R)-1-diazo-3-(methylamino)-4-(2,4,5-trifluorophenyl)butan-2-one |
|---|---|
| PubChem CID | 173476816 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (3R)-1-diazo-3-(methylamino)-4-(2,4,5-trifluorophenyl)butan-2-one |
| SMILES | CN[C@H](Cc1cc(F)c(F)cc1F)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C11H10F3N3O/c1-16-10(11(18)5-17-15)3-6-2-8(13)9(14)4-7(6)12/h2,4-5,10,16H,3H2,1H3/t10-/m1/s1 |
| InChIKey | PMKHWCDFMBOYBP-SNVBAGLBSA-N |
| XLogP | 1.10 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|