C9H8F3NO2 — CID 7016597
(2R)-2-azaniumyl-3-(2,4,5-trifluorophenyl)propanoate (PubChem CID 7016597) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is (2R)-2-azaniumyl-3-(2,4,5-trifluorophenyl)propanoate.
| Compound Name | (2R)-2-azaniumyl-3-(2,4,5-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 7016597 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (2R)-2-azaniumyl-3-(2,4,5-trifluorophenyl)propanoate |
| SMILES | [NH3+][C@H](Cc1cc(F)c(F)cc1F)C(=O)[O-] |
| InChI | InChI=1S/C9H8F3NO2/c10-5-3-7(12)6(11)1-4(5)2-8(13)9(14)15/h1,3,8H,2,13H2,(H,14,15)/t8-/m1/s1 |
| InChIKey | SWJFYJHCOWRRLR-MRVPVSSYSA-N |
| XLogP | -0.99 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|