C9H10F3NO2 — CID 118888699
(2R)-2-amino-3-(2,4,5-trifluorophenyl)propane-1,1-diol (PubChem CID 118888699) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is (2R)-2-amino-3-(2,4,5-trifluorophenyl)propane-1,1-diol.
| Compound Name | (2R)-2-amino-3-(2,4,5-trifluorophenyl)propane-1,1-diol |
|---|---|
| PubChem CID | 118888699 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2R)-2-amino-3-(2,4,5-trifluorophenyl)propane-1,1-diol |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C(O)O |
| InChI | InChI=1S/C9H10F3NO2/c10-5-3-7(12)6(11)1-4(5)2-8(13)9(14)15/h1,3,8-9,14-15H,2,13H2/t8-/m1/s1 |
| InChIKey | NOKJXBBLWVVODG-MRVPVSSYSA-N |
| XLogP | 0.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|