C22H24F6N2O2 — CID 89475569
2-[(2S,3R)-3-amino-2-hydroxy-4-(2,4,5-trifluorophenyl)butyl]-N-tert-butyl-4-(trifluoromethyl)benzamide (PubChem CID 89475569) has the molecular formula C22H24F6N2O2 and a molecular weight of 462.43 g/mol. Its IUPAC name is 2-[(2S,3R)-3-amino-2-hydroxy-4-(2,4,5-trifluorophenyl)butyl]-N-tert-butyl-4-(trifluoromethyl)benzamide.
| Compound Name | 2-[(2S,3R)-3-amino-2-hydroxy-4-(2,4,5-trifluorophenyl)butyl]-N-tert-butyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 89475569 |
| Molecular Formula | C22H24F6N2O2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[(2S,3R)-3-amino-2-hydroxy-4-(2,4,5-trifluorophenyl)butyl]-N-tert-butyl-4-(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(C(F)(F)F)cc1C[C@H](O)[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H24F6N2O2/c1-21(2,3)30-20(32)14-5-4-13(22(26,27)28)6-11(14)9-19(31)18(29)8-12-7-16(24)17(25)10-15(12)23/h4-7,10,18-19,31H,8-9,29H2,1-3H3,(H,30,32)/t18-,19+/m1/s1 |
| InChIKey | JLGRXJBENUWJIF-MOPGFXCFSA-N |
| XLogP | 4.12 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|