C20H24ClF2N3O2 — CID 66638851
2-[(2S,3R)-3-amino-4-(4-chloro-2,5-difluorophenyl)-2-hydroxybutyl]-N-tert-butylpyridine-3-carboxamide (PubChem CID 66638851) has the molecular formula C20H24ClF2N3O2 and a molecular weight of 411.88 g/mol. Its IUPAC name is 2-[(2S,3R)-3-amino-4-(4-chloro-2,5-difluorophenyl)-2-hydroxybutyl]-N-tert-butylpyridine-3-carboxamide.
| Compound Name | 2-[(2S,3R)-3-amino-4-(4-chloro-2,5-difluorophenyl)-2-hydroxybutyl]-N-tert-butylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 66638851 |
| Molecular Formula | C20H24ClF2N3O2 |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[(2S,3R)-3-amino-4-(4-chloro-2,5-difluorophenyl)-2-hydroxybutyl]-N-tert-butylpyridine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cccnc1C[C@H](O)[C@H](N)Cc1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C20H24ClF2N3O2/c1-20(2,3)26-19(28)12-5-4-6-25-17(12)10-18(27)16(24)8-11-7-15(23)13(21)9-14(11)22/h4-7,9,16,18,27H,8,10,24H2,1-3H3,(H,26,28)/t16-,18+/m1/s1 |
| InChIKey | WJMDFNDGXHYKJR-AEFFLSMTSA-N |
| XLogP | 3.01 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|