C21H26ClFN2O2 — CID 73230510
2-[3-amino-4-(2-fluorophenyl)-2-hydroxybutyl]-N-tert-butyl-6-chlorobenzamide (PubChem CID 73230510) has the molecular formula C21H26ClFN2O2 and a molecular weight of 392.90 g/mol. Its IUPAC name is 2-[3-amino-4-(2-fluorophenyl)-2-hydroxybutyl]-N-tert-butyl-6-chlorobenzamide.
| Compound Name | 2-[3-amino-4-(2-fluorophenyl)-2-hydroxybutyl]-N-tert-butyl-6-chlorobenzamide |
|---|---|
| PubChem CID | 73230510 |
| Molecular Formula | C21H26ClFN2O2 |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[3-amino-4-(2-fluorophenyl)-2-hydroxybutyl]-N-tert-butyl-6-chlorobenzamide |
| SMILES | CC(C)(C)NC(=O)c1c(Cl)cccc1CC(O)C(N)Cc1ccccc1F |
| InChI | InChI=1S/C21H26ClFN2O2/c1-21(2,3)25-20(27)19-14(8-6-9-15(19)22)12-18(26)17(24)11-13-7-4-5-10-16(13)23/h4-10,17-18,26H,11-12,24H2,1-3H3,(H,25,27) |
| InChIKey | DBXPDCHNPHGPRW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |