C28H28F3N3O4 — CID 66639506
benzyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-2-pyridinyl]-3-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 66639506) has the molecular formula C28H28F3N3O4 and a molecular weight of 527.54 g/mol. Its IUPAC name is benzyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-2-pyridinyl]-3-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-2-pyridinyl]-3-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 66639506 |
| Molecular Formula | C28H28F3N3O4 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | benzyl N-[(2R)-4-[3-(tert-butylcarbamoyl)-2-pyridinyl]-3-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)NC(=O)c1cccnc1CC(=O)[C@@H](Cc1cc(F)c(F)cc1F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H28F3N3O4/c1-28(2,3)34-26(36)19-10-7-11-32-23(19)15-25(35)24(13-18-12-21(30)22(31)14-20(18)29)33-27(37)38-16-17-8-5-4-6-9-17/h4-12,14,24H,13,15-16H2,1-3H3,(H,33,37)(H,34,36)/t24-/m1/s1 |
| InChIKey | PYESHRYNQBKUQT-XMMPIXPASA-N |
| XLogP | 4.68 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|