C13H15F4NO — CID 138963598
N-tert-butyl-5-fluoro-2-(2,2,2-trifluoroethyl)benzamide (PubChem CID 138963598) has the molecular formula C13H15F4NO and a molecular weight of 277.26 g/mol. Its IUPAC name is N-tert-butyl-5-fluoro-2-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-tert-butyl-5-fluoro-2-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 138963598 |
| Molecular Formula | C13H15F4NO |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-tert-butyl-5-fluoro-2-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CC(C)(C)NC(=O)c1cc(F)ccc1CC(F)(F)F |
| InChI | InChI=1S/C13H15F4NO/c1-12(2,3)18-11(19)10-6-9(14)5-4-8(10)7-13(15,16)17/h4-6H,7H2,1-3H3,(H,18,19) |
| InChIKey | GGPINYITGCYSHM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |