C11H15F3N2O — CID 123927783
3-amino-1-(methylamino)-4-(2,4,5-trifluorophenyl)butan-1-ol (PubChem CID 123927783) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 3-amino-1-(methylamino)-4-(2,4,5-trifluorophenyl)butan-1-ol.
| Compound Name | 3-amino-1-(methylamino)-4-(2,4,5-trifluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 123927783 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-amino-1-(methylamino)-4-(2,4,5-trifluorophenyl)butan-1-ol |
| SMILES | CNC(O)CC(N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H15F3N2O/c1-16-11(17)4-7(15)2-6-3-9(13)10(14)5-8(6)12/h3,5,7,11,16-17H,2,4,15H2,1H3 |
| InChIKey | WQBUSPXQDBWUJE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|