C16H15F4N3O — CID 142400489
1-[2-amino-3-(2,4,5-trifluorophenyl)propyl]-3-(4-fluorophenyl)urea (PubChem CID 142400489) has the molecular formula C16H15F4N3O and a molecular weight of 341.31 g/mol. Its IUPAC name is 1-[2-amino-3-(2,4,5-trifluorophenyl)propyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[2-amino-3-(2,4,5-trifluorophenyl)propyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 142400489 |
| Molecular Formula | C16H15F4N3O |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[2-amino-3-(2,4,5-trifluorophenyl)propyl]-3-(4-fluorophenyl)urea |
| SMILES | NC(CNC(=O)Nc1ccc(F)cc1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H15F4N3O/c17-10-1-3-12(4-2-10)23-16(24)22-8-11(21)5-9-6-14(19)15(20)7-13(9)18/h1-4,6-7,11H,5,8,21H2,(H2,22,23,24) |
| InChIKey | SJKVJSUSMPXEEA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|