C21H29F3N2O5 — CID 66728559
3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid (PubChem CID 66728559) has the molecular formula C21H29F3N2O5 and a molecular weight of 446.47 g/mol. Its IUPAC name is 3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid.
| Compound Name | 3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 66728559 |
| Molecular Formula | C21H29F3N2O5 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-4-(2,4,5-trifluorophenyl)butanoic acid |
| SMILES | CCC(C)C(NC(=O)OC(C)(C)C)C(=O)NC(CC(=O)O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H29F3N2O5/c1-6-11(2)18(26-20(30)31-21(3,4)5)19(29)25-13(9-17(27)28)7-12-8-15(23)16(24)10-14(12)22/h8,10-11,13,18H,6-7,9H2,1-5H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | DBJCWVLOYCVHSA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|