C30H38F6N2O6 — CID 161466066
tert-butyl N-[(2R)-4-hydroxy-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;tert-butyl N-[(2R)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 161466066) has the molecular formula C30H38F6N2O6 and a molecular weight of 636.63 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-hydroxy-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;tert-butyl N-[(2R)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-hydroxy-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;tert-butyl N-[(2R)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 161466066 |
| Molecular Formula | C30H38F6N2O6 |
| Molecular Weight | 636.63 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | tert-butyl N-[(2R)-4-hydroxy-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;tert-butyl N-[(2R)-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=O)Cc1cc(F)c(F)cc1F.CC(C)(C)OC(=O)N[C@@H](CCO)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H20F3NO3.C15H18F3NO3/c2*1-15(2,3)22-14(21)19-10(4-5-20)6-9-7-12(17)13(18)8-11(9)16/h7-8,10,20H,4-6H2,1-3H3,(H,19,21);5,7-8,10H,4,6H2,1-3H3,(H,19,21)/t2*10-/m00/s1 |
| InChIKey | WCLIXZIQZFBHTA-LARVRRBISA-N |
| XLogP | 6.05 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|