C26H37BrF6N4O3 — CID 143807601
1-bromo-3,7-dimethyl-3-(trifluoromethyl)-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine;tert-butyl N-[4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane (PubChem CID 143807601) has the molecular formula C26H37BrF6N4O3 and a molecular weight of 647.50 g/mol. Its IUPAC name is 1-bromo-3,7-dimethyl-3-(trifluoromethyl)-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine;tert-butyl N-[4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane.
| Compound Name | 1-bromo-3,7-dimethyl-3-(trifluoromethyl)-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine;tert-butyl N-[4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 143807601 |
| Molecular Formula | C26H37BrF6N4O3 |
| Molecular Weight | 647.50 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 1-bromo-3,7-dimethyl-3-(trifluoromethyl)-2,5,6,8-tetrahydroimidazo[1,5-a]pyrazine;tert-butyl N-[4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC(CC=O)Cc1cc(F)c(F)cc1F.CN1CCN2C(=C(Br)NC2(C)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H18F3NO3.C9H13BrF3N3.C2H6/c1-15(2,3)22-14(21)19-10(4-5-20)6-9-7-12(17)13(18)8-11(9)16;1-8(9(11,12)13)14-7(10)6-5-15(2)3-4-16(6)8;1-2/h5,7-8,10H,4,6H2,1-3H3,(H,19,21);14H,3-5H2,1-2H3;1-2H3 |
| InChIKey | BKSCMMVDULQETM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|