C26H26F6N4O3S — CID 143807472
tert-butyl N-[(2R)-4-oxo-4-[1-thiophen-2-yl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 143807472) has the molecular formula C26H26F6N4O3S and a molecular weight of 588.57 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-oxo-4-[1-thiophen-2-yl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-oxo-4-[1-thiophen-2-yl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 143807472 |
| Molecular Formula | C26H26F6N4O3S |
| Molecular Weight | 588.57 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | tert-butyl N-[(2R)-4-oxo-4-[1-thiophen-2-yl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N1CCn2c(C(F)(F)F)nc(-c3cccs3)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H26F6N4O3S/c1-25(2,3)39-24(38)33-15(9-14-10-17(28)18(29)12-16(14)27)11-21(37)35-6-7-36-19(13-35)22(20-5-4-8-40-20)34-23(36)26(30,31)32/h4-5,8,10,12,15H,6-7,9,11,13H2,1-3H3,(H,33,38)/t15-/m1/s1 |
| InChIKey | HHFBIGGKWUANRR-OAHLLOKOSA-N |
| XLogP | 5.92 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|