C29H30F6N4O5S — CID 174608436
tert-butyl N-[(2R)-4-[1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 174608436) has the molecular formula C29H30F6N4O5S and a molecular weight of 660.64 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 174608436 |
| Molecular Formula | C29H30F6N4O5S |
| Molecular Weight | 660.64 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | tert-butyl N-[(2R)-4-[1-(4-methylsulfonylphenyl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N1CCn2c(C(F)(F)F)nc(-c3ccc(S(C)(=O)=O)cc3)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C29H30F6N4O5S/c1-28(2,3)44-27(41)36-18(11-17-12-21(31)22(32)14-20(17)30)13-24(40)38-9-10-39-23(15-38)25(37-26(39)29(33,34)35)16-5-7-19(8-6-16)45(4,42)43/h5-8,12,14,18H,9-11,13,15H2,1-4H3,(H,36,41)/t18-/m1/s1 |
| InChIKey | UNPSLXROENHWHE-GOSISDBHSA-N |
| XLogP | 5.26 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|