C26H26F6N4O4 — CID 143807569
tert-butyl N-[(2R)-4-[1-(furan-3-yl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate (PubChem CID 143807569) has the molecular formula C26H26F6N4O4 and a molecular weight of 572.51 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[1-(furan-3-yl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[1-(furan-3-yl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 143807569 |
| Molecular Formula | C26H26F6N4O4 |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | tert-butyl N-[(2R)-4-[1-(furan-3-yl)-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]-4-oxo-1-(2,4,5-trifluorophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N1CCn2c(C(F)(F)F)nc(-c3ccoc3)c2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C26H26F6N4O4/c1-25(2,3)40-24(38)33-16(8-15-9-18(28)19(29)11-17(15)27)10-21(37)35-5-6-36-20(12-35)22(14-4-7-39-13-14)34-23(36)26(30,31)32/h4,7,9,11,13,16H,5-6,8,10,12H2,1-3H3,(H,33,38)/t16-/m1/s1 |
| InChIKey | LQJRWUWWDQBJJC-MRXNPFEDSA-N |
| XLogP | 5.45 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|