C26H29F6N5O6 — CID 59548956
methyl 2-[[7-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbonyl]amino]acetate (PubChem CID 59548956) has the molecular formula C26H29F6N5O6 and a molecular weight of 621.54 g/mol. Its IUPAC name is methyl 2-[[7-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[7-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 59548956 |
| Molecular Formula | C26H29F6N5O6 |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | methyl 2-[[7-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoyl]-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1nc(C(F)(F)F)n2c1CN(C(=O)C[C@@H](Cc1cc(F)c(F)cc1F)NC(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C26H29F6N5O6/c1-25(2,3)43-24(41)34-14(7-13-8-16(28)17(29)10-15(13)27)9-19(38)36-5-6-37-18(12-36)21(35-23(37)26(30,31)32)22(40)33-11-20(39)42-4/h8,10,14H,5-7,9,11-12H2,1-4H3,(H,33,40)(H,34,41)/t14-/m1/s1 |
| InChIKey | KRUOUMZUQOYCPH-CQSZACIVSA-N |
| XLogP | 3.09 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|